C11H14ClN3O3S — CID 106250243
5-amino-2-chloro-N-(1-methyl-2-oxopyrrolidin-3-yl)benzenesulfonamide (PubChem CID 106250243) has the molecular formula C11H14ClN3O3S and a molecular weight of 303.77 g/mol. Its IUPAC name is 5-amino-2-chloro-N-(1-methyl-2-oxopyrrolidin-3-yl)benzenesulfonamide.
| Compound Name | 5-amino-2-chloro-N-(1-methyl-2-oxopyrrolidin-3-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106250243 |
| Molecular Formula | C11H14ClN3O3S |
| Molecular Weight | 303.77 g/mol |
| Exact Mass | 303.04 |
| IUPAC Name | 5-amino-2-chloro-N-(1-methyl-2-oxopyrrolidin-3-yl)benzenesulfonamide |
| SMILES | CN1CCC(NS(=O)(=O)c2cc(N)ccc2Cl)C1=O |
| InChI | InChI=1S/C11H14ClN3O3S/c1-15-5-4-9(11(15)16)14-19(17,18)10-6-7(13)2-3-8(10)12/h2-3,6,9,14H,4-5,13H2,1H3 |
| InChIKey | DMMFVYPDUTVJBF-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 92.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.77 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|