C17H20N2O2 — CID 15157701
[3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl] acetate (PubChem CID 15157701) has the molecular formula C17H20N2O2 and a molecular weight of 284.36 g/mol. Its IUPAC name is [3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl] acetate.
| Compound Name | [3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl] acetate |
|---|---|
| PubChem CID | 15157701 |
| Molecular Formula | C17H20N2O2 |
| Molecular Weight | 284.36 g/mol |
| Exact Mass | 284.15 |
| IUPAC Name | [3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl] acetate |
| SMILES | CC(=O)Oc1ccc2[nH]cc(C3CN4CCC3CC4)c2c1 |
| InChI | InChI=1S/C17H20N2O2/c1-11(20)21-13-2-3-17-14(8-13)15(9-18-17)16-10-19-6-4-12(16)5-7-19/h2-3,8-9,12,16,18H,4-7,10H2,1H3 |
| InChIKey | YQSOOBKSYHDVBS-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 45.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|