C21H23N3S — CID 58415976
2-[3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl]-1-thiophen-2-ylethanimine (PubChem CID 58415976) has the molecular formula C21H23N3S and a molecular weight of 349.50 g/mol. Its IUPAC name is 2-[3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl]-1-thiophen-2-ylethanimine.
| Compound Name | 2-[3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl]-1-thiophen-2-ylethanimine |
|---|---|
| PubChem CID | 58415976 |
| Molecular Formula | C21H23N3S |
| Molecular Weight | 349.50 g/mol |
| Exact Mass | 349.16 |
| IUPAC Name | 2-[3-(1-azabicyclo[2.2.2]octan-3-yl)-1H-indol-5-yl]-1-thiophen-2-ylethanimine |
| SMILES | [H]/N=C(/Cc1ccc2[nH]cc(C3CN4CCC3CC4)c2c1)c1cccs1 |
| InChI | InChI=1S/C21H23N3S/c22-19(21-2-1-9-25-21)11-14-3-4-20-16(10-14)17(12-23-20)18-13-24-7-5-15(18)6-8-24/h1-4,9-10,12,15,18,22-23H,5-8,11,13H2/b22-19- |
| InChIKey | OPLXDXGDWQVBPV-QOCHGBHMSA-N |
| XLogP | 4.65 |
| TPSA | 42.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.50 |
| LogP ≤ 5 | 4.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|