C13H17NS — CID 58279934
3-(1-thiophen-2-ylethenyl)-1-azabicyclo[2.2.2]octane (PubChem CID 58279934) has the molecular formula C13H17NS and a molecular weight of 219.35 g/mol. Its IUPAC name is 3-(1-thiophen-2-ylethenyl)-1-azabicyclo[2.2.2]octane.
| Compound Name | 3-(1-thiophen-2-ylethenyl)-1-azabicyclo[2.2.2]octane |
|---|---|
| PubChem CID | 58279934 |
| Molecular Formula | C13H17NS |
| Molecular Weight | 219.35 g/mol |
| Exact Mass | 219.11 |
| IUPAC Name | 3-(1-thiophen-2-ylethenyl)-1-azabicyclo[2.2.2]octane |
| SMILES | C=C(c1cccs1)C1CN2CCC1CC2 |
| InChI | InChI=1S/C13H17NS/c1-10(13-3-2-8-15-13)12-9-14-6-4-11(12)5-7-14/h2-3,8,11-12H,1,4-7,9H2 |
| InChIKey | UYYKOACZFJCBOR-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.35 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |