C10H13NOS — CID 11074319
4-(1-thiophen-2-ylethenyl)morpholine (PubChem CID 11074319) has the molecular formula C10H13NOS and a molecular weight of 195.29 g/mol. Its IUPAC name is 4-(1-thiophen-2-ylethenyl)morpholine.
| Compound Name | 4-(1-thiophen-2-ylethenyl)morpholine |
|---|---|
| PubChem CID | 11074319 |
| Molecular Formula | C10H13NOS |
| Molecular Weight | 195.29 g/mol |
| Exact Mass | 195.07 |
| IUPAC Name | 4-(1-thiophen-2-ylethenyl)morpholine |
| SMILES | C=C(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C10H13NOS/c1-9(10-3-2-8-13-10)11-4-6-12-7-5-11/h2-3,8H,1,4-7H2 |
| InChIKey | OKDRBYVXIMCRKN-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.29 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |