C12H16N4O3S — CID 5174655
N-[N-(methylcarbamoyl)-C-morpholin-4-ylcarbonimidoyl]thiophene-2-carboxamide (PubChem CID 5174655) has the molecular formula C12H16N4O3S and a molecular weight of 296.35 g/mol. Its IUPAC name is N-[N-(methylcarbamoyl)-C-morpholin-4-ylcarbonimidoyl]thiophene-2-carboxamide.
| Compound Name | N-[N-(methylcarbamoyl)-C-morpholin-4-ylcarbonimidoyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 5174655 |
| Molecular Formula | C12H16N4O3S |
| Molecular Weight | 296.35 g/mol |
| Exact Mass | 296.09 |
| IUPAC Name | N-[N-(methylcarbamoyl)-C-morpholin-4-ylcarbonimidoyl]thiophene-2-carboxamide |
| SMILES | CNC(=O)N=C(NC(=O)c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C12H16N4O3S/c1-13-12(18)15-11(16-4-6-19-7-5-16)14-10(17)9-3-2-8-20-9/h2-3,8H,4-7H2,1H3,(H2,13,14,15,17,18) |
| InChIKey | MGXDEBWUXVROQW-UHFFFAOYSA-N |
| XLogP | 0.51 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.35 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|