C18H23N3O5S — CID 55470357
1-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazin-1-yl]-4-thiophen-2-ylbutane-1,4-dione (PubChem CID 55470357) has the molecular formula C18H23N3O5S and a molecular weight of 393.47 g/mol. Its IUPAC name is 1-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazin-1-yl]-4-thiophen-2-ylbutane-1,4-dione.
| Compound Name | 1-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazin-1-yl]-4-thiophen-2-ylbutane-1,4-dione |
|---|---|
| PubChem CID | 55470357 |
| Molecular Formula | C18H23N3O5S |
| Molecular Weight | 393.47 g/mol |
| Exact Mass | 393.14 |
| IUPAC Name | 1-[4-(2-morpholin-4-yl-2-oxoacetyl)piperazin-1-yl]-4-thiophen-2-ylbutane-1,4-dione |
| SMILES | O=C(CCC(=O)N1CCN(C(=O)C(=O)N2CCOCC2)CC1)c1cccs1 |
| InChI | InChI=1S/C18H23N3O5S/c22-14(15-2-1-13-27-15)3-4-16(23)19-5-7-20(8-6-19)17(24)18(25)21-9-11-26-12-10-21/h1-2,13H,3-12H2 |
| InChIKey | KKJJBDGSLHGTOR-UHFFFAOYSA-N |
| XLogP | 0.24 |
| TPSA | 87.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.47 |
| LogP ≤ 5 | 0.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|