C18H26Cl2N4S — CID 57341332
N'-[1-[3-(methylamino)propyl]-3,4-dihydro-2H-quinolin-6-yl]thiophene-2-carboximidamide;dihydrochloride (PubChem CID 57341332) has the molecular formula C18H26Cl2N4S and a molecular weight of 401.41 g/mol. Its IUPAC name is N'-[1-[3-(methylamino)propyl]-3,4-dihydro-2H-quinolin-6-yl]thiophene-2-carboximidamide;dihydrochloride.
| Compound Name | N'-[1-[3-(methylamino)propyl]-3,4-dihydro-2H-quinolin-6-yl]thiophene-2-carboximidamide;dihydrochloride |
|---|---|
| PubChem CID | 57341332 |
| Molecular Formula | C18H26Cl2N4S |
| Molecular Weight | 401.41 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N'-[1-[3-(methylamino)propyl]-3,4-dihydro-2H-quinolin-6-yl]thiophene-2-carboximidamide;dihydrochloride |
| SMILES | CNCCCN1CCCc2cc(/N=C(\N)c3cccs3)ccc21.Cl.Cl |
| InChI | InChI=1S/C18H24N4S.2ClH/c1-20-9-4-11-22-10-2-5-14-13-15(7-8-16(14)22)21-18(19)17-6-3-12-23-17;;/h3,6-8,12-13,20H,2,4-5,9-11H2,1H3,(H2,19,21);2*1H |
| InChIKey | JXLSISFXQPNFIJ-UHFFFAOYSA-N |
| XLogP | 3.99 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.41 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|