C35H48N8OS4 — CID 158287401
bis(N'-[4-[2-(ethylamino)ethyl]-2,3-dihydro-1,4-benzothiazin-6-yl]thiophene-2-carboximidamide);methanol (PubChem CID 158287401) has the molecular formula C35H48N8OS4 and a molecular weight of 725.09 g/mol. Its IUPAC name is bis(N'-[4-[2-(ethylamino)ethyl]-2,3-dihydro-1,4-benzothiazin-6-yl]thiophene-2-carboximidamide);methanol.
| Compound Name | bis(N'-[4-[2-(ethylamino)ethyl]-2,3-dihydro-1,4-benzothiazin-6-yl]thiophene-2-carboximidamide);methanol |
|---|---|
| PubChem CID | 158287401 |
| Molecular Formula | C35H48N8OS4 |
| Molecular Weight | 725.09 g/mol |
| Exact Mass | 724.28 |
| IUPAC Name | bis(N'-[4-[2-(ethylamino)ethyl]-2,3-dihydro-1,4-benzothiazin-6-yl]thiophene-2-carboximidamide);methanol |
| SMILES | CCNCCN1CCSc2ccc(/N=C(\N)c3cccs3)cc21.CCNCCN1CCSc2ccc(/N=C(\N)c3cccs3)cc21.CO |
| InChI | InChI=1S/2C17H22N4S2.CH4O/c2*1-2-19-7-8-21-9-11-23-15-6-5-13(12-14(15)21)20-17(18)16-4-3-10-22-16;1-2/h2*3-6,10,12,19H,2,7-9,11H2,1H3,(H2,18,20);2H,1H3 |
| InChIKey | GKYDMKKHWOOVQW-UHFFFAOYSA-N |
| XLogP | 6.22 |
| TPSA | 127.53 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 48 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.09 |
| LogP ≤ 5 | 6.22 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|