C18H22N4S — CID 59807080
N'-[1-[2-(methylamino)ethyl]-2-methylidene-3,4-dihydroquinolin-6-yl]thiophene-2-carboximidamide (PubChem CID 59807080) has the molecular formula C18H22N4S and a molecular weight of 326.47 g/mol. Its IUPAC name is N'-[1-[2-(methylamino)ethyl]-2-methylidene-3,4-dihydroquinolin-6-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[1-[2-(methylamino)ethyl]-2-methylidene-3,4-dihydroquinolin-6-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 59807080 |
| Molecular Formula | C18H22N4S |
| Molecular Weight | 326.47 g/mol |
| Exact Mass | 326.16 |
| IUPAC Name | N'-[1-[2-(methylamino)ethyl]-2-methylidene-3,4-dihydroquinolin-6-yl]thiophene-2-carboximidamide |
| SMILES | C=C1CCc2cc(/N=C(\N)c3cccs3)ccc2N1CCNC |
| InChI | InChI=1S/C18H22N4S/c1-13-5-6-14-12-15(21-18(19)17-4-3-11-23-17)7-8-16(14)22(13)10-9-20-2/h3-4,7-8,11-12,20H,1,5-6,9-10H2,2H3,(H2,19,21) |
| InChIKey | FTAUKXVGOJOSJH-UHFFFAOYSA-N |
| XLogP | 3.27 |
| TPSA | 53.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.47 |
| LogP ≤ 5 | 3.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|