C21H21N3S — CID 23298450
N'-(2-benzyl-3,4-dihydro-1H-isoquinolin-7-yl)thiophene-2-carboximidamide (PubChem CID 23298450) has the molecular formula C21H21N3S and a molecular weight of 347.49 g/mol. Its IUPAC name is N'-(2-benzyl-3,4-dihydro-1H-isoquinolin-7-yl)thiophene-2-carboximidamide.
| Compound Name | N'-(2-benzyl-3,4-dihydro-1H-isoquinolin-7-yl)thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 23298450 |
| Molecular Formula | C21H21N3S |
| Molecular Weight | 347.49 g/mol |
| Exact Mass | 347.15 |
| IUPAC Name | N'-(2-benzyl-3,4-dihydro-1H-isoquinolin-7-yl)thiophene-2-carboximidamide |
| SMILES | N/C(=N\c1ccc2c(c1)CN(Cc1ccccc1)CC2)c1cccs1 |
| InChI | InChI=1S/C21H21N3S/c22-21(20-7-4-12-25-20)23-19-9-8-17-10-11-24(15-18(17)13-19)14-16-5-2-1-3-6-16/h1-9,12-13H,10-11,14-15H2,(H2,22,23) |
| InChIKey | HRRRBYAOHBLDFF-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 41.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.49 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|