C16H22N2 — CID 123227825
5-methyl-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indole (PubChem CID 123227825) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 5-methyl-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indole.
| Compound Name | 5-methyl-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indole |
|---|---|
| PubChem CID | 123227825 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 5-methyl-1-[2-(1-methylpyrrolidin-2-yl)ethyl]indole |
| SMILES | Cc1ccc2c(ccn2CCC2CCCN2C)c1 |
| InChI | InChI=1S/C16H22N2/c1-13-5-6-16-14(12-13)7-10-18(16)11-8-15-4-3-9-17(15)2/h5-7,10,12,15H,3-4,8-9,11H2,1-2H3 |
| InChIKey | QITMNRGFWPBLAD-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |