C16H22N2 — CID 167666538
5-methyl-1-[[(2R)-1-methylpiperidin-2-yl]methyl]indole (PubChem CID 167666538) has the molecular formula C16H22N2 and a molecular weight of 242.37 g/mol. Its IUPAC name is 5-methyl-1-[[(2R)-1-methylpiperidin-2-yl]methyl]indole.
| Compound Name | 5-methyl-1-[[(2R)-1-methylpiperidin-2-yl]methyl]indole |
|---|---|
| PubChem CID | 167666538 |
| Molecular Formula | C16H22N2 |
| Molecular Weight | 242.37 g/mol |
| Exact Mass | 242.18 |
| IUPAC Name | 5-methyl-1-[[(2R)-1-methylpiperidin-2-yl]methyl]indole |
| SMILES | Cc1ccc2c(ccn2C[C@H]2CCCCN2C)c1 |
| InChI | InChI=1S/C16H22N2/c1-13-6-7-16-14(11-13)8-10-18(16)12-15-5-3-4-9-17(15)2/h6-8,10-11,15H,3-5,9,12H2,1-2H3/t15-/m1/s1 |
| InChIKey | SSNPIDHUBXFDQV-OAHLLOKOSA-N |
| XLogP | 3.43 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.37 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |