C17H24N2 — CID 92981302
2-methyl-1-[2-[(2R)-1-methylpiperidin-2-yl]ethyl]indole (PubChem CID 92981302) has the molecular formula C17H24N2 and a molecular weight of 256.39 g/mol. Its IUPAC name is 2-methyl-1-[2-[(2R)-1-methylpiperidin-2-yl]ethyl]indole.
| Compound Name | 2-methyl-1-[2-[(2R)-1-methylpiperidin-2-yl]ethyl]indole |
|---|---|
| PubChem CID | 92981302 |
| Molecular Formula | C17H24N2 |
| Molecular Weight | 256.39 g/mol |
| Exact Mass | 256.19 |
| IUPAC Name | 2-methyl-1-[2-[(2R)-1-methylpiperidin-2-yl]ethyl]indole |
| SMILES | Cc1cc2ccccc2n1CC[C@H]1CCCCN1C |
| InChI | InChI=1S/C17H24N2/c1-14-13-15-7-3-4-9-17(15)19(14)12-10-16-8-5-6-11-18(16)2/h3-4,7,9,13,16H,5-6,8,10-12H2,1-2H3/t16-/m1/s1 |
| InChIKey | QYPVWSRCWDPUKX-MRXNPFEDSA-N |
| XLogP | 3.82 |
| TPSA | 8.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.39 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |