C16H21NO — CID 65165792
2-methyl-1-[3-(oxolan-2-yl)propyl]indole (PubChem CID 65165792) has the molecular formula C16H21NO and a molecular weight of 243.35 g/mol. Its IUPAC name is 2-methyl-1-[3-(oxolan-2-yl)propyl]indole.
| Compound Name | 2-methyl-1-[3-(oxolan-2-yl)propyl]indole |
|---|---|
| PubChem CID | 65165792 |
| Molecular Formula | C16H21NO |
| Molecular Weight | 243.35 g/mol |
| Exact Mass | 243.16 |
| IUPAC Name | 2-methyl-1-[3-(oxolan-2-yl)propyl]indole |
| SMILES | Cc1cc2ccccc2n1CCCC1CCCO1 |
| InChI | InChI=1S/C16H21NO/c1-13-12-14-6-2-3-9-16(14)17(13)10-4-7-15-8-5-11-18-15/h2-3,6,9,12,15H,4-5,7-8,10-11H2,1H3 |
| InChIKey | ZSSULKVZFUAYEL-UHFFFAOYSA-N |
| XLogP | 3.91 |
| TPSA | 14.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.35 |
| LogP ≤ 5 | 3.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |