C21H24N4O2 — CID 56995113
N-(3-methyl-2-nitrophenyl)-1-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-5-amine (PubChem CID 56995113) has the molecular formula C21H24N4O2 and a molecular weight of 364.45 g/mol. Its IUPAC name is N-(3-methyl-2-nitrophenyl)-1-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-5-amine.
| Compound Name | N-(3-methyl-2-nitrophenyl)-1-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-5-amine |
|---|---|
| PubChem CID | 56995113 |
| Molecular Formula | C21H24N4O2 |
| Molecular Weight | 364.45 g/mol |
| Exact Mass | 364.19 |
| IUPAC Name | N-(3-methyl-2-nitrophenyl)-1-[[(2R)-1-methylpyrrolidin-2-yl]methyl]indol-5-amine |
| SMILES | Cc1cccc(Nc2ccc3c(ccn3C[C@H]3CCCN3C)c2)c1[N+](=O)[O-] |
| InChI | InChI=1S/C21H24N4O2/c1-15-5-3-7-19(21(15)25(26)27)22-17-8-9-20-16(13-17)10-12-24(20)14-18-6-4-11-23(18)2/h3,5,7-10,12-13,18,22H,4,6,11,14H2,1-2H3/t18-/m1/s1 |
| InChIKey | IXGAJPVIPSGBJR-GOSISDBHSA-N |
| XLogP | 4.70 |
| TPSA | 63.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.45 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|