C19H21IN4OS — CID 145480764
N'-[1-(1-iodopiperidin-4-yl)-3-methyl-2-oxo-3H-indol-5-yl]thiophene-2-carboximidamide (PubChem CID 145480764) has the molecular formula C19H21IN4OS and a molecular weight of 480.38 g/mol. Its IUPAC name is N'-[1-(1-iodopiperidin-4-yl)-3-methyl-2-oxo-3H-indol-5-yl]thiophene-2-carboximidamide.
| Compound Name | N'-[1-(1-iodopiperidin-4-yl)-3-methyl-2-oxo-3H-indol-5-yl]thiophene-2-carboximidamide |
|---|---|
| PubChem CID | 145480764 |
| Molecular Formula | C19H21IN4OS |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 480.05 |
| IUPAC Name | N'-[1-(1-iodopiperidin-4-yl)-3-methyl-2-oxo-3H-indol-5-yl]thiophene-2-carboximidamide |
| SMILES | CC1C(=O)N(C2CCN(I)CC2)c2ccc(/N=C(\N)c3cccs3)cc21 |
| InChI | InChI=1S/C19H21IN4OS/c1-12-15-11-13(22-18(21)17-3-2-10-26-17)4-5-16(15)24(19(12)25)14-6-8-23(20)9-7-14/h2-5,10-12,14H,6-9H2,1H3,(H2,21,22) |
| InChIKey | MWWUHGCPJLSNSW-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 61.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'N-halo', 'substructure': 'N/A'} |
|---|