C13H12O2S — CID 13404184
(2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone (PubChem CID 13404184) has the molecular formula C13H12O2S and a molecular weight of 232.30 g/mol. Its IUPAC name is (2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone.
| Compound Name | (2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 13404184 |
| Molecular Formula | C13H12O2S |
| Molecular Weight | 232.30 g/mol |
| Exact Mass | 232.06 |
| IUPAC Name | (2-hydroxy-3,5-dimethylphenyl)-thiophen-2-ylmethanone |
| SMILES | Cc1cc(C)c(O)c(C(=O)c2cccs2)c1 |
| InChI | InChI=1S/C13H12O2S/c1-8-6-9(2)12(14)10(7-8)13(15)11-4-3-5-16-11/h3-7,14H,1-2H3 |
| InChIKey | VIWRNRWYKCQLJO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.30 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |