C14H11NO2S2 — CID 154058921
(3,5-dimethyl-2-sulfanylidene-1,3-benzoxazol-6-yl)-thiophen-2-ylmethanone (PubChem CID 154058921) has the molecular formula C14H11NO2S2 and a molecular weight of 289.38 g/mol. Its IUPAC name is (3,5-dimethyl-2-sulfanylidene-1,3-benzoxazol-6-yl)-thiophen-2-ylmethanone.
| Compound Name | (3,5-dimethyl-2-sulfanylidene-1,3-benzoxazol-6-yl)-thiophen-2-ylmethanone |
|---|---|
| PubChem CID | 154058921 |
| Molecular Formula | C14H11NO2S2 |
| Molecular Weight | 289.38 g/mol |
| Exact Mass | 289.02 |
| IUPAC Name | (3,5-dimethyl-2-sulfanylidene-1,3-benzoxazol-6-yl)-thiophen-2-ylmethanone |
| SMILES | Cc1cc2c(cc1C(=O)c1cccs1)oc(=S)n2C |
| InChI | InChI=1S/C14H11NO2S2/c1-8-6-10-11(17-14(18)15(10)2)7-9(8)13(16)12-4-3-5-19-12/h3-7H,1-2H3 |
| InChIKey | HAMGANPNHPFOMU-UHFFFAOYSA-N |
| XLogP | 4.10 |
| TPSA | 35.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.38 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|