C9H3Cl3N2 — CID 82269544
2,5,6-trichloro-1H-indole-3-carbonitrile (PubChem CID 82269544) has the molecular formula C9H3Cl3N2 and a molecular weight of 245.50 g/mol. Its IUPAC name is 2,5,6-trichloro-1H-indole-3-carbonitrile.
| Compound Name | 2,5,6-trichloro-1H-indole-3-carbonitrile |
|---|---|
| PubChem CID | 82269544 |
| Molecular Formula | C9H3Cl3N2 |
| Molecular Weight | 245.50 g/mol |
| Exact Mass | 243.94 |
| IUPAC Name | 2,5,6-trichloro-1H-indole-3-carbonitrile |
| SMILES | N#Cc1c(Cl)[nH]c2cc(Cl)c(Cl)cc12 |
| InChI | InChI=1S/C9H3Cl3N2/c10-6-1-4-5(3-13)9(12)14-8(4)2-7(6)11/h1-2,14H |
| InChIKey | CIASEDSKXNOKMG-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.50 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |