C9H4Cl2N2 — CID 137347280
5,6-dichloro-1H-indole-2-carbonitrile (PubChem CID 137347280) has the molecular formula C9H4Cl2N2 and a molecular weight of 211.05 g/mol. Its IUPAC name is 5,6-dichloro-1H-indole-2-carbonitrile.
| Compound Name | 5,6-dichloro-1H-indole-2-carbonitrile |
|---|---|
| PubChem CID | 137347280 |
| Molecular Formula | C9H4Cl2N2 |
| Molecular Weight | 211.05 g/mol |
| Exact Mass | 209.98 |
| IUPAC Name | 5,6-dichloro-1H-indole-2-carbonitrile |
| SMILES | N#Cc1cc2cc(Cl)c(Cl)cc2[nH]1 |
| InChI | InChI=1S/C9H4Cl2N2/c10-7-2-5-1-6(4-12)13-9(5)3-8(7)11/h1-3,13H |
| InChIKey | LUDHJXRKLHYFBJ-UHFFFAOYSA-N |
| XLogP | 3.35 |
| TPSA | 39.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.05 |
| LogP ≤ 5 | 3.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |