C8H3Cl2N3 — CID 130051786
2,6-dichloro-1H-benzimidazole-5-carbonitrile (PubChem CID 130051786) has the molecular formula C8H3Cl2N3 and a molecular weight of 212.04 g/mol. Its IUPAC name is 2,6-dichloro-1H-benzimidazole-5-carbonitrile.
| Compound Name | 2,6-dichloro-1H-benzimidazole-5-carbonitrile |
|---|---|
| PubChem CID | 130051786 |
| Molecular Formula | C8H3Cl2N3 |
| Molecular Weight | 212.04 g/mol |
| Exact Mass | 210.97 |
| IUPAC Name | 2,6-dichloro-1H-benzimidazole-5-carbonitrile |
| SMILES | N#Cc1cc2nc(Cl)[nH]c2cc1Cl |
| InChI | InChI=1S/C8H3Cl2N3/c9-5-2-7-6(1-4(5)3-11)12-8(10)13-7/h1-2H,(H,12,13) |
| InChIKey | NRFLZQPTKFNHHB-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.04 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |