C12H18N2O2 — CID 91248042
ethane;8-hydroxy-6H-1,6-naphthyridin-5-one (PubChem CID 91248042) has the molecular formula C12H18N2O2 and a molecular weight of 222.29 g/mol. Its IUPAC name is ethane;8-hydroxy-6H-1,6-naphthyridin-5-one.
| Compound Name | ethane;8-hydroxy-6H-1,6-naphthyridin-5-one |
|---|---|
| PubChem CID | 91248042 |
| Molecular Formula | C12H18N2O2 |
| Molecular Weight | 222.29 g/mol |
| Exact Mass | 222.14 |
| IUPAC Name | ethane;8-hydroxy-6H-1,6-naphthyridin-5-one |
| SMILES | CC.CC.O=c1[nH]cc(O)c2ncccc12 |
| InChI | InChI=1S/C8H6N2O2.2C2H6/c11-6-4-10-8(12)5-2-1-3-9-7(5)6;2*1-2/h1-4,11H,(H,10,12);2*1-2H3 |
| InChIKey | AZFSFTGMLFPMMT-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 65.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 222.29 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |