C10H11N5O — CID 171099237
5-[(Z)-1-amino-2-hydrazinylethenyl]-7H-1,7-naphthyridin-8-one (PubChem CID 171099237) has the molecular formula C10H11N5O and a molecular weight of 217.23 g/mol. Its IUPAC name is 5-[(Z)-1-amino-2-hydrazinylethenyl]-7H-1,7-naphthyridin-8-one.
| Compound Name | 5-[(Z)-1-amino-2-hydrazinylethenyl]-7H-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 171099237 |
| Molecular Formula | C10H11N5O |
| Molecular Weight | 217.23 g/mol |
| Exact Mass | 217.10 |
| IUPAC Name | 5-[(Z)-1-amino-2-hydrazinylethenyl]-7H-1,7-naphthyridin-8-one |
| SMILES | NN/C=C(\N)c1c[nH]c(=O)c2ncccc12 |
| InChI | InChI=1S/C10H11N5O/c11-8(5-15-12)7-4-14-10(16)9-6(7)2-1-3-13-9/h1-5,15H,11-12H2,(H,14,16)/b8-5- |
| InChIKey | IMYKYOGQFACXKP-YVMONPNESA-N |
| XLogP | -0.36 |
| TPSA | 109.82 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.23 |
| LogP ≤ 5 | -0.36 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|