C15H17N3O2 — CID 164631526
5-[(3S)-3-methylpiperidine-1-carbonyl]-7H-1,7-naphthyridin-8-one (PubChem CID 164631526) has the molecular formula C15H17N3O2 and a molecular weight of 271.32 g/mol. Its IUPAC name is 5-[(3S)-3-methylpiperidine-1-carbonyl]-7H-1,7-naphthyridin-8-one.
| Compound Name | 5-[(3S)-3-methylpiperidine-1-carbonyl]-7H-1,7-naphthyridin-8-one |
|---|---|
| PubChem CID | 164631526 |
| Molecular Formula | C15H17N3O2 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.13 |
| IUPAC Name | 5-[(3S)-3-methylpiperidine-1-carbonyl]-7H-1,7-naphthyridin-8-one |
| SMILES | C[C@H]1CCCN(C(=O)c2c[nH]c(=O)c3ncccc23)C1 |
| InChI | InChI=1S/C15H17N3O2/c1-10-4-3-7-18(9-10)15(20)12-8-17-14(19)13-11(12)5-2-6-16-13/h2,5-6,8,10H,3-4,7,9H2,1H3,(H,17,19)/t10-/m0/s1 |
| InChIKey | RGABVXGBOUZZKX-JTQLQIEISA-N |
| XLogP | 1.80 |
| TPSA | 66.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 1.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |