C10H9N3O2 — CID 20750074
8-hydroxy-5-methyl-1,6-naphthyridine-7-carboxamide (PubChem CID 20750074) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is 8-hydroxy-5-methyl-1,6-naphthyridine-7-carboxamide.
| Compound Name | 8-hydroxy-5-methyl-1,6-naphthyridine-7-carboxamide |
|---|---|
| PubChem CID | 20750074 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | 8-hydroxy-5-methyl-1,6-naphthyridine-7-carboxamide |
| SMILES | Cc1nc(C(N)=O)c(O)c2ncccc12 |
| InChI | InChI=1S/C10H9N3O2/c1-5-6-3-2-4-12-7(6)9(14)8(13-5)10(11)15/h2-4,14H,1H3,(H2,11,15) |
| InChIKey | LYNAOSZBOYPZSN-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 89.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |