C13H16BrFN2O2 — CID 94187519
(2R,6R)-N-(2-bromo-4-fluorophenyl)-2,6-dimethylmorpholine-4-carboxamide (PubChem CID 94187519) has the molecular formula C13H16BrFN2O2 and a molecular weight of 331.19 g/mol. Its IUPAC name is (2R,6R)-N-(2-bromo-4-fluorophenyl)-2,6-dimethylmorpholine-4-carboxamide.
| Compound Name | (2R,6R)-N-(2-bromo-4-fluorophenyl)-2,6-dimethylmorpholine-4-carboxamide |
|---|---|
| PubChem CID | 94187519 |
| Molecular Formula | C13H16BrFN2O2 |
| Molecular Weight | 331.19 g/mol |
| Exact Mass | 330.04 |
| IUPAC Name | (2R,6R)-N-(2-bromo-4-fluorophenyl)-2,6-dimethylmorpholine-4-carboxamide |
| SMILES | C[C@@H]1CN(C(=O)Nc2ccc(F)cc2Br)C[C@@H](C)O1 |
| InChI | InChI=1S/C13H16BrFN2O2/c1-8-6-17(7-9(2)19-8)13(18)16-12-4-3-10(15)5-11(12)14/h3-5,8-9H,6-7H2,1-2H3,(H,16,18)/t8-,9-/m1/s1 |
| InChIKey | PGVLZOCRHKKHMO-RKDXNWHRSA-N |
| XLogP | 3.23 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.19 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |