C16H23NOS — CID 40963206
[(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-propan-2-ylphenyl)methanethione (PubChem CID 40963206) has the molecular formula C16H23NOS and a molecular weight of 277.43 g/mol. Its IUPAC name is [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-propan-2-ylphenyl)methanethione.
| Compound Name | [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-propan-2-ylphenyl)methanethione |
|---|---|
| PubChem CID | 40963206 |
| Molecular Formula | C16H23NOS |
| Molecular Weight | 277.43 g/mol |
| Exact Mass | 277.15 |
| IUPAC Name | [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(4-propan-2-ylphenyl)methanethione |
| SMILES | CC(C)c1ccc(C(=S)N2C[C@H](C)O[C@@H](C)C2)cc1 |
| InChI | InChI=1S/C16H23NOS/c1-11(2)14-5-7-15(8-6-14)16(19)17-9-12(3)18-13(4)10-17/h5-8,11-13H,9-10H2,1-4H3/t12-,13-/m0/s1 |
| InChIKey | QOFHQLDEVVBGJQ-STQMWFEESA-N |
| XLogP | 3.59 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.43 |
| LogP ≤ 5 | 3.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|