C16H23NO4S — CID 40963230
[(2S,6S)-2,6-dimethylmorpholin-4-yl]-(3,4,5-trimethoxyphenyl)methanethione (PubChem CID 40963230) has the molecular formula C16H23NO4S and a molecular weight of 325.43 g/mol. Its IUPAC name is [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(3,4,5-trimethoxyphenyl)methanethione.
| Compound Name | [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(3,4,5-trimethoxyphenyl)methanethione |
|---|---|
| PubChem CID | 40963230 |
| Molecular Formula | C16H23NO4S |
| Molecular Weight | 325.43 g/mol |
| Exact Mass | 325.13 |
| IUPAC Name | [(2S,6S)-2,6-dimethylmorpholin-4-yl]-(3,4,5-trimethoxyphenyl)methanethione |
| SMILES | COc1cc(C(=S)N2C[C@H](C)O[C@@H](C)C2)cc(OC)c1OC |
| InChI | InChI=1S/C16H23NO4S/c1-10-8-17(9-11(2)21-10)16(22)12-6-13(18-3)15(20-5)14(7-12)19-4/h6-7,10-11H,8-9H2,1-5H3/t10-,11-/m0/s1 |
| InChIKey | NEMOZOUNRBMOKL-QWRGUYRKSA-N |
| XLogP | 2.50 |
| TPSA | 40.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.43 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|