About [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione
[(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione (PubChem CID 137129262) has the molecular formula C15H20INO3S
and a molecular weight of 421.30 g/mol. Its IUPAC name is [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione.
Molecular Properties
| Compound Name | [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione |
| PubChem CID | 137129262 |
| Molecular Formula | C15H20INO3S |
| Molecular Weight | 421.30 g/mol |
| Exact Mass | 421.02 |
| IUPAC Name | [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione |
| SMILES | CCOc1cc(C(=S)N2C[C@@H](C)O[C@H](C)C2)cc(I)c1O |
| InChI | InChI=1S/C15H20INO3S/c1-4-19-13-6-11(5-12(16)14(13)18)15(21)17-7-9(2)20-10(3)8-17/h5-6,9-10,18H,4,7-8H2,1-3H3/t9-,10-/m1/s1 |
| InChIKey | ZMWNANTUVVRMRJ-NXEZZACHSA-N |
| XLogP | 3.18 |
| TPSA | 41.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 421.30 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione?
The IUPAC name of [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione (CID 137129262) is [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione.
What is the SMILES notation for [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione?
The canonical SMILES for [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione is CCOc1cc(C(=S)N2C[C@@H](C)O[C@H](C)C2)cc(I)c1O.
What is the InChIKey of [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione?
The InChIKey is ZMWNANTUVVRMRJ-NXEZZACHSA-N. The full InChI is InChI=1S/C15H20INO3S/c1-4-19-13-6-11(5-12(16)14(13)18)15(21)17-7-9(2)20-10(3)8-17/h5-6,9-10,18H,4,7-8H2,1-3H3/t9-,10-/m1/s1.
What are the key properties of [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione?
[(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione has a molecular weight of 421.30 g/mol, XLogP of 3.18, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [(2R,6R)-2,6-dimethylmorpholin-4-yl]-(3-ethoxy-4-hydroxy-5-iodophenyl)methanethione is sourced from PubChem (CID 137129262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).