C25H31BrN2O4S — CID 126271248
2-[2-bromo-4-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-6-ethoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide (PubChem CID 126271248) has the molecular formula C25H31BrN2O4S and a molecular weight of 535.50 g/mol. Its IUPAC name is 2-[2-bromo-4-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-6-ethoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide.
| Compound Name | 2-[2-bromo-4-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-6-ethoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126271248 |
| Molecular Formula | C25H31BrN2O4S |
| Molecular Weight | 535.50 g/mol |
| Exact Mass | 534.12 |
| IUPAC Name | 2-[2-bromo-4-[(2R,6R)-2,6-dimethylmorpholine-4-carbothioyl]-6-ethoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide |
| SMILES | CCOc1cc(C(=S)N2C[C@@H](C)O[C@H](C)C2)cc(Br)c1OCC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C25H31BrN2O4S/c1-6-30-22-11-19(25(33)28-12-17(4)32-18(5)13-28)10-21(26)24(22)31-14-23(29)27-20-8-15(2)7-16(3)9-20/h7-11,17-18H,6,12-14H2,1-5H3,(H,27,29)/t17-,18-/m1/s1 |
| InChIKey | NOVGNNXLVHXCSC-QZTJIDSGSA-N |
| XLogP | 5.27 |
| TPSA | 60.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.50 |
| LogP ≤ 5 | 5.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|