C24H29BrN2O3S — CID 126261406
2-[2-bromo-6-ethoxy-4-(piperidine-1-carbothioyl)phenoxy]-N-(3,5-dimethylphenyl)acetamide (PubChem CID 126261406) has the molecular formula C24H29BrN2O3S and a molecular weight of 505.48 g/mol. Its IUPAC name is 2-[2-bromo-6-ethoxy-4-(piperidine-1-carbothioyl)phenoxy]-N-(3,5-dimethylphenyl)acetamide.
| Compound Name | 2-[2-bromo-6-ethoxy-4-(piperidine-1-carbothioyl)phenoxy]-N-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126261406 |
| Molecular Formula | C24H29BrN2O3S |
| Molecular Weight | 505.48 g/mol |
| Exact Mass | 504.11 |
| IUPAC Name | 2-[2-bromo-6-ethoxy-4-(piperidine-1-carbothioyl)phenoxy]-N-(3,5-dimethylphenyl)acetamide |
| SMILES | CCOc1cc(C(=S)N2CCCCC2)cc(Br)c1OCC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C24H29BrN2O3S/c1-4-29-21-14-18(24(31)27-8-6-5-7-9-27)13-20(25)23(21)30-15-22(28)26-19-11-16(2)10-17(3)12-19/h10-14H,4-9,15H2,1-3H3,(H,26,28) |
| InChIKey | HLLCVSTUJPZDTG-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 505.48 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|