C22H25ClN2O3S — CID 126251653
2-[2-chloro-6-ethoxy-4-(pyrrolidine-1-carbothioyl)phenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126251653) has the molecular formula C22H25ClN2O3S and a molecular weight of 432.97 g/mol. Its IUPAC name is 2-[2-chloro-6-ethoxy-4-(pyrrolidine-1-carbothioyl)phenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[2-chloro-6-ethoxy-4-(pyrrolidine-1-carbothioyl)phenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126251653 |
| Molecular Formula | C22H25ClN2O3S |
| Molecular Weight | 432.97 g/mol |
| Exact Mass | 432.13 |
| IUPAC Name | 2-[2-chloro-6-ethoxy-4-(pyrrolidine-1-carbothioyl)phenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C(=S)N2CCCC2)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C22H25ClN2O3S/c1-3-27-19-13-16(22(29)25-10-4-5-11-25)12-18(23)21(19)28-14-20(26)24-17-8-6-15(2)7-9-17/h6-9,12-13H,3-5,10-11,14H2,1-2H3,(H,24,26) |
| InChIKey | UGXWRBZIIFFYCK-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.97 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|