C30H33ClN2O3S — CID 126278506
2-[4-(4-benzylpiperidine-1-carbothioyl)-2-chloro-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide (PubChem CID 126278506) has the molecular formula C30H33ClN2O3S and a molecular weight of 537.13 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperidine-1-carbothioyl)-2-chloro-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide.
| Compound Name | 2-[4-(4-benzylpiperidine-1-carbothioyl)-2-chloro-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
|---|---|
| PubChem CID | 126278506 |
| Molecular Formula | C30H33ClN2O3S |
| Molecular Weight | 537.13 g/mol |
| Exact Mass | 536.19 |
| IUPAC Name | 2-[4-(4-benzylpiperidine-1-carbothioyl)-2-chloro-6-ethoxyphenoxy]-N-(4-methylphenyl)acetamide |
| SMILES | CCOc1cc(C(=S)N2CCC(Cc3ccccc3)CC2)cc(Cl)c1OCC(=O)Nc1ccc(C)cc1 |
| InChI | InChI=1S/C30H33ClN2O3S/c1-3-35-27-19-24(30(37)33-15-13-23(14-16-33)17-22-7-5-4-6-8-22)18-26(31)29(27)36-20-28(34)32-25-11-9-21(2)10-12-25/h4-12,18-19,23H,3,13-17,20H2,1-2H3,(H,32,34) |
| InChIKey | YFEUBRBJEGFEBY-UHFFFAOYSA-N |
| XLogP | 6.69 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.13 |
| LogP ≤ 5 | 6.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|