C28H29BrN2O3S — CID 126270629
2-[4-(4-benzylpiperidine-1-carbothioyl)-2-methoxyphenoxy]-N-(4-bromophenyl)acetamide (PubChem CID 126270629) has the molecular formula C28H29BrN2O3S and a molecular weight of 553.52 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperidine-1-carbothioyl)-2-methoxyphenoxy]-N-(4-bromophenyl)acetamide.
| Compound Name | 2-[4-(4-benzylpiperidine-1-carbothioyl)-2-methoxyphenoxy]-N-(4-bromophenyl)acetamide |
|---|---|
| PubChem CID | 126270629 |
| Molecular Formula | C28H29BrN2O3S |
| Molecular Weight | 553.52 g/mol |
| Exact Mass | 552.11 |
| IUPAC Name | 2-[4-(4-benzylpiperidine-1-carbothioyl)-2-methoxyphenoxy]-N-(4-bromophenyl)acetamide |
| SMILES | COc1cc(C(=S)N2CCC(Cc3ccccc3)CC2)ccc1OCC(=O)Nc1ccc(Br)cc1 |
| InChI | InChI=1S/C28H29BrN2O3S/c1-33-26-18-22(7-12-25(26)34-19-27(32)30-24-10-8-23(29)9-11-24)28(35)31-15-13-21(14-16-31)17-20-5-3-2-4-6-20/h2-12,18,21H,13-17,19H2,1H3,(H,30,32) |
| InChIKey | FWDZYEDJLGJTHW-UHFFFAOYSA-N |
| XLogP | 6.11 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.52 |
| LogP ≤ 5 | 6.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|