C28H28Cl2N2O3S — CID 126276472
2-[4-(4-benzylpiperidine-1-carbothioyl)-2-methoxyphenoxy]-N-(3,5-dichlorophenyl)acetamide (PubChem CID 126276472) has the molecular formula C28H28Cl2N2O3S and a molecular weight of 543.52 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperidine-1-carbothioyl)-2-methoxyphenoxy]-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2-[4-(4-benzylpiperidine-1-carbothioyl)-2-methoxyphenoxy]-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 126276472 |
| Molecular Formula | C28H28Cl2N2O3S |
| Molecular Weight | 543.52 g/mol |
| Exact Mass | 542.12 |
| IUPAC Name | 2-[4-(4-benzylpiperidine-1-carbothioyl)-2-methoxyphenoxy]-N-(3,5-dichlorophenyl)acetamide |
| SMILES | COc1cc(C(=S)N2CCC(Cc3ccccc3)CC2)ccc1OCC(=O)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C28H28Cl2N2O3S/c1-34-26-14-21(28(36)32-11-9-20(10-12-32)13-19-5-3-2-4-6-19)7-8-25(26)35-18-27(33)31-24-16-22(29)15-23(30)17-24/h2-8,14-17,20H,9-13,18H2,1H3,(H,31,33) |
| InChIKey | PBMHLEPNUNMOBO-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 50.80 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.52 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|