C26H25Cl2N3O2S — CID 126256819
2-[4-(4-benzylpiperazine-1-carbothioyl)phenoxy]-N-(3,5-dichlorophenyl)acetamide (PubChem CID 126256819) has the molecular formula C26H25Cl2N3O2S and a molecular weight of 514.48 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperazine-1-carbothioyl)phenoxy]-N-(3,5-dichlorophenyl)acetamide.
| Compound Name | 2-[4-(4-benzylpiperazine-1-carbothioyl)phenoxy]-N-(3,5-dichlorophenyl)acetamide |
|---|---|
| PubChem CID | 126256819 |
| Molecular Formula | C26H25Cl2N3O2S |
| Molecular Weight | 514.48 g/mol |
| Exact Mass | 513.10 |
| IUPAC Name | 2-[4-(4-benzylpiperazine-1-carbothioyl)phenoxy]-N-(3,5-dichlorophenyl)acetamide |
| SMILES | O=C(COc1ccc(C(=S)N2CCN(Cc3ccccc3)CC2)cc1)Nc1cc(Cl)cc(Cl)c1 |
| InChI | InChI=1S/C26H25Cl2N3O2S/c27-21-14-22(28)16-23(15-21)29-25(32)18-33-24-8-6-20(7-9-24)26(34)31-12-10-30(11-13-31)17-19-4-2-1-3-5-19/h1-9,14-16H,10-13,17-18H2,(H,29,32) |
| InChIKey | MHESSIFOLNYKKN-UHFFFAOYSA-N |
| XLogP | 5.50 |
| TPSA | 44.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.48 |
| LogP ≤ 5 | 5.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|