C29H33N3O3S — CID 126263965
2-[4-(4-benzylpiperazine-1-carbothioyl)-2-methoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide (PubChem CID 126263965) has the molecular formula C29H33N3O3S and a molecular weight of 503.67 g/mol. Its IUPAC name is 2-[4-(4-benzylpiperazine-1-carbothioyl)-2-methoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide.
| Compound Name | 2-[4-(4-benzylpiperazine-1-carbothioyl)-2-methoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide |
|---|---|
| PubChem CID | 126263965 |
| Molecular Formula | C29H33N3O3S |
| Molecular Weight | 503.67 g/mol |
| Exact Mass | 503.22 |
| IUPAC Name | 2-[4-(4-benzylpiperazine-1-carbothioyl)-2-methoxyphenoxy]-N-(3,5-dimethylphenyl)acetamide |
| SMILES | COc1cc(C(=S)N2CCN(Cc3ccccc3)CC2)ccc1OCC(=O)Nc1cc(C)cc(C)c1 |
| InChI | InChI=1S/C29H33N3O3S/c1-21-15-22(2)17-25(16-21)30-28(33)20-35-26-10-9-24(18-27(26)34-3)29(36)32-13-11-31(12-14-32)19-23-7-5-4-6-8-23/h4-10,15-18H,11-14,19-20H2,1-3H3,(H,30,33) |
| InChIKey | QGOVPUKXPMMUQP-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 54.04 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.67 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|