C14H19NO3S — CID 969955
pyrrolidin-1-yl-(3,4,5-trimethoxyphenyl)methanethione (PubChem CID 969955) has the molecular formula C14H19NO3S and a molecular weight of 281.38 g/mol. Its IUPAC name is pyrrolidin-1-yl-(3,4,5-trimethoxyphenyl)methanethione.
| Compound Name | pyrrolidin-1-yl-(3,4,5-trimethoxyphenyl)methanethione |
|---|---|
| PubChem CID | 969955 |
| Molecular Formula | C14H19NO3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | pyrrolidin-1-yl-(3,4,5-trimethoxyphenyl)methanethione |
| SMILES | COc1cc(C(=S)N2CCCC2)cc(OC)c1OC |
| InChI | InChI=1S/C14H19NO3S/c1-16-11-8-10(9-12(17-2)13(11)18-3)14(19)15-6-4-5-7-15/h8-9H,4-7H2,1-3H3 |
| InChIKey | WJHNXCXMGWAEPW-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 30.93 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|