C14H15F4NO2S — CID 91285366
[3,4-dimethoxy-5-(trifluoromethyl)phenyl]-[(3S)-3-fluoropyrrolidin-1-yl]methanethione (PubChem CID 91285366) has the molecular formula C14H15F4NO2S and a molecular weight of 337.34 g/mol. Its IUPAC name is [3,4-dimethoxy-5-(trifluoromethyl)phenyl]-[(3S)-3-fluoropyrrolidin-1-yl]methanethione.
| Compound Name | [3,4-dimethoxy-5-(trifluoromethyl)phenyl]-[(3S)-3-fluoropyrrolidin-1-yl]methanethione |
|---|---|
| PubChem CID | 91285366 |
| Molecular Formula | C14H15F4NO2S |
| Molecular Weight | 337.34 g/mol |
| Exact Mass | 337.08 |
| IUPAC Name | [3,4-dimethoxy-5-(trifluoromethyl)phenyl]-[(3S)-3-fluoropyrrolidin-1-yl]methanethione |
| SMILES | COc1cc(C(=S)N2CC[C@H](F)C2)cc(C(F)(F)F)c1OC |
| InChI | InChI=1S/C14H15F4NO2S/c1-20-11-6-8(13(22)19-4-3-9(15)7-19)5-10(12(11)21-2)14(16,17)18/h5-6,9H,3-4,7H2,1-2H3/t9-/m0/s1 |
| InChIKey | XTVDCFLTQDTLBC-VIFPVBQESA-N |
| XLogP | 3.44 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.34 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|