C14H14F3NO3S — CID 87802996
(2R)-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylic acid (PubChem CID 87802996) has the molecular formula C14H14F3NO3S and a molecular weight of 333.33 g/mol. Its IUPAC name is (2R)-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87802996 |
| Molecular Formula | C14H14F3NO3S |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.06 |
| IUPAC Name | (2R)-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C(=S)N2CCC[C@@H]2C(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C14H14F3NO3S/c1-21-11-5-4-8(7-9(11)14(15,16)17)12(22)18-6-2-3-10(18)13(19)20/h4-5,7,10H,2-3,6H2,1H3,(H,19,20)/t10-/m1/s1 |
| InChIKey | MSTPWOGJFGCVCU-SNVBAGLBSA-N |
| XLogP | 2.94 |
| TPSA | 49.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|