C14H17F3N2O4S — CID 87802995
hydroxylamine;(2R)-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylic acid (PubChem CID 87802995) has the molecular formula C14H17F3N2O4S and a molecular weight of 366.36 g/mol. Its IUPAC name is hydroxylamine;(2R)-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylic acid.
| Compound Name | hydroxylamine;(2R)-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87802995 |
| Molecular Formula | C14H17F3N2O4S |
| Molecular Weight | 366.36 g/mol |
| Exact Mass | 366.09 |
| IUPAC Name | hydroxylamine;(2R)-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxylic acid |
| SMILES | COc1ccc(C(=S)N2CCC[C@@H]2C(=O)O)cc1C(F)(F)F.NO |
| InChI | InChI=1S/C14H14F3NO3S.H3NO/c1-21-11-5-4-8(7-9(11)14(15,16)17)12(22)18-6-2-3-10(18)13(19)20;1-2/h4-5,7,10H,2-3,6H2,1H3,(H,19,20);2H,1H2/t10-;/m1./s1 |
| InChIKey | SDULHKLFUFYVHD-HNCPQSOCSA-N |
| XLogP | 2.27 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.36 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|