C14H14F6N2O4S — CID 87546720
hydroxylamine;1-[4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid (PubChem CID 87546720) has the molecular formula C14H14F6N2O4S and a molecular weight of 420.33 g/mol. Its IUPAC name is hydroxylamine;1-[4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid.
| Compound Name | hydroxylamine;1-[4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 87546720 |
| Molecular Formula | C14H14F6N2O4S |
| Molecular Weight | 420.33 g/mol |
| Exact Mass | 420.06 |
| IUPAC Name | hydroxylamine;1-[4-(2,2,2-trifluoroethoxy)-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylic acid |
| SMILES | NO.O=C(O)C1CCN1C(=S)c1ccc(OCC(F)(F)F)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C14H11F6NO3S.H3NO/c15-13(16,17)6-24-10-2-1-7(5-8(10)14(18,19)20)11(25)21-4-3-9(21)12(22)23;1-2/h1-2,5,9H,3-4,6H2,(H,22,23);2H,1H2 |
| InChIKey | LNBYYPSFWIXCCS-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.33 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|