C18H22F3NO2S — CID 87540412
methyl (2R)-1-[4-pentyl-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylate (PubChem CID 87540412) has the molecular formula C18H22F3NO2S and a molecular weight of 373.44 g/mol. Its IUPAC name is methyl (2R)-1-[4-pentyl-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylate.
| Compound Name | methyl (2R)-1-[4-pentyl-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylate |
|---|---|
| PubChem CID | 87540412 |
| Molecular Formula | C18H22F3NO2S |
| Molecular Weight | 373.44 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | methyl (2R)-1-[4-pentyl-3-(trifluoromethyl)benzenecarbothioyl]azetidine-2-carboxylate |
| SMILES | CCCCCc1ccc(C(=S)N2CC[C@@H]2C(=O)OC)cc1C(F)(F)F |
| InChI | InChI=1S/C18H22F3NO2S/c1-3-4-5-6-12-7-8-13(11-14(12)18(19,20)21)16(25)22-10-9-15(22)17(23)24-2/h7-8,11,15H,3-6,9-10H2,1-2H3/t15-/m1/s1 |
| InChIKey | REIVXKVCYNANRS-OAHLLOKOSA-N |
| XLogP | 4.36 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.44 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|