C14H15F3N2O3S — CID 87077791
(2R)-N-hydroxy-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxamide (PubChem CID 87077791) has the molecular formula C14H15F3N2O3S and a molecular weight of 348.35 g/mol. Its IUPAC name is (2R)-N-hydroxy-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxamide.
| Compound Name | (2R)-N-hydroxy-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxamide |
|---|---|
| PubChem CID | 87077791 |
| Molecular Formula | C14H15F3N2O3S |
| Molecular Weight | 348.35 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | (2R)-N-hydroxy-1-[4-methoxy-3-(trifluoromethyl)benzenecarbothioyl]pyrrolidine-2-carboxamide |
| SMILES | COc1ccc(C(=S)N2CCC[C@@H]2C(=O)NO)cc1C(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O3S/c1-22-11-5-4-8(7-9(11)14(15,16)17)13(23)19-6-2-3-10(19)12(20)18-21/h4-5,7,10,21H,2-3,6H2,1H3,(H,18,20)/t10-/m1/s1 |
| InChIKey | LVBNAJJCYWWOTJ-SNVBAGLBSA-N |
| XLogP | 2.36 |
| TPSA | 61.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.35 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|