C13H13F3N2O5 — CID 85079953
N-hydroxy-1-[4-methoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxamide (PubChem CID 85079953) has the molecular formula C13H13F3N2O5 and a molecular weight of 334.25 g/mol. Its IUPAC name is N-hydroxy-1-[4-methoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxamide.
| Compound Name | N-hydroxy-1-[4-methoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxamide |
|---|---|
| PubChem CID | 85079953 |
| Molecular Formula | C13H13F3N2O5 |
| Molecular Weight | 334.25 g/mol |
| Exact Mass | 334.08 |
| IUPAC Name | N-hydroxy-1-[4-methoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxamide |
| SMILES | COc1ccc(C(=O)N2CCC2C(=O)NO)cc1OC(F)(F)F |
| InChI | InChI=1S/C13H13F3N2O5/c1-22-9-3-2-7(6-10(9)23-13(14,15)16)12(20)18-5-4-8(18)11(19)17-21/h2-3,6,8,21H,4-5H2,1H3,(H,17,19) |
| InChIKey | ZGZXFTWCWNAQLZ-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.25 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|