C14H15F3N2O4 — CID 85087240
1-[4-ethyl-3-(trifluoromethoxy)benzoyl]-N-hydroxyazetidine-2-carboxamide (PubChem CID 85087240) has the molecular formula C14H15F3N2O4 and a molecular weight of 332.28 g/mol. Its IUPAC name is 1-[4-ethyl-3-(trifluoromethoxy)benzoyl]-N-hydroxyazetidine-2-carboxamide.
| Compound Name | 1-[4-ethyl-3-(trifluoromethoxy)benzoyl]-N-hydroxyazetidine-2-carboxamide |
|---|---|
| PubChem CID | 85087240 |
| Molecular Formula | C14H15F3N2O4 |
| Molecular Weight | 332.28 g/mol |
| Exact Mass | 332.10 |
| IUPAC Name | 1-[4-ethyl-3-(trifluoromethoxy)benzoyl]-N-hydroxyazetidine-2-carboxamide |
| SMILES | CCc1ccc(C(=O)N2CCC2C(=O)NO)cc1OC(F)(F)F |
| InChI | InChI=1S/C14H15F3N2O4/c1-2-8-3-4-9(7-11(8)23-14(15,16)17)13(21)19-6-5-10(19)12(20)18-22/h3-4,7,10,22H,2,5-6H2,1H3,(H,18,20) |
| InChIKey | SKUJJSNQTVGFLE-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.28 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|