C13H12F3NO4S — CID 69383411
(2R)-1-[4-methylsulfanyl-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxylic acid (PubChem CID 69383411) has the molecular formula C13H12F3NO4S and a molecular weight of 335.30 g/mol. Its IUPAC name is (2R)-1-[4-methylsulfanyl-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxylic acid.
| Compound Name | (2R)-1-[4-methylsulfanyl-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxylic acid |
|---|---|
| PubChem CID | 69383411 |
| Molecular Formula | C13H12F3NO4S |
| Molecular Weight | 335.30 g/mol |
| Exact Mass | 335.04 |
| IUPAC Name | (2R)-1-[4-methylsulfanyl-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxylic acid |
| SMILES | CSc1ccc(C(=O)N2CC[C@@H]2C(=O)O)cc1OC(F)(F)F |
| InChI | InChI=1S/C13H12F3NO4S/c1-22-10-3-2-7(6-9(10)21-13(14,15)16)11(18)17-5-4-8(17)12(19)20/h2-3,6,8H,4-5H2,1H3,(H,19,20)/t8-/m1/s1 |
| InChIKey | WMXMDKWXPPGUPU-MRVPVSSYSA-N |
| XLogP | 2.61 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.30 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |