C15H15F3N2O5 — CID 85146678
N-hydroxy-1-[4-prop-2-enoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxamide (PubChem CID 85146678) has the molecular formula C15H15F3N2O5 and a molecular weight of 360.29 g/mol. Its IUPAC name is N-hydroxy-1-[4-prop-2-enoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxamide.
| Compound Name | N-hydroxy-1-[4-prop-2-enoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxamide |
|---|---|
| PubChem CID | 85146678 |
| Molecular Formula | C15H15F3N2O5 |
| Molecular Weight | 360.29 g/mol |
| Exact Mass | 360.09 |
| IUPAC Name | N-hydroxy-1-[4-prop-2-enoxy-3-(trifluoromethoxy)benzoyl]azetidine-2-carboxamide |
| SMILES | C=CCOc1ccc(C(=O)N2CCC2C(=O)NO)cc1OC(F)(F)F |
| InChI | InChI=1S/C15H15F3N2O5/c1-2-7-24-11-4-3-9(8-12(11)25-15(16,17)18)14(22)20-6-5-10(20)13(21)19-23/h2-4,8,10,23H,1,5-7H2,(H,19,21) |
| InChIKey | FYEXLVSSCPCKFU-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 88.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.29 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|