C10H10F3NO2 — CID 68685743
4-prop-2-enoxy-3-(trifluoromethoxy)aniline (PubChem CID 68685743) has the molecular formula C10H10F3NO2 and a molecular weight of 233.19 g/mol. Its IUPAC name is 4-prop-2-enoxy-3-(trifluoromethoxy)aniline.
| Compound Name | 4-prop-2-enoxy-3-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 68685743 |
| Molecular Formula | C10H10F3NO2 |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 233.07 |
| IUPAC Name | 4-prop-2-enoxy-3-(trifluoromethoxy)aniline |
| SMILES | C=CCOc1ccc(N)cc1OC(F)(F)F |
| InChI | InChI=1S/C10H10F3NO2/c1-2-5-15-8-4-3-7(14)6-9(8)16-10(11,12)13/h2-4,6H,1,5,14H2 |
| InChIKey | UADJZYQXOXMDID-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 44.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|